C14H16F3NO4 — CID 51050189
(2S)-2-amino-1-[(2S)-2-methyloxiran-2-yl]-3-phenylpropan-1-one;2,2,2-trifluoroacetic acid (PubChem CID 51050189) has the molecular formula C14H16F3NO4 and a molecular weight of 319.28 g/mol. Its IUPAC name is (2S)-2-amino-1-[(2S)-2-methyloxiran-2-yl]-3-phenylpropan-1-one;2,2,2-trifluoroacetic acid.
| Compound Name | (2S)-2-amino-1-[(2S)-2-methyloxiran-2-yl]-3-phenylpropan-1-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 51050189 |
| Molecular Formula | C14H16F3NO4 |
| Molecular Weight | 319.28 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | (2S)-2-amino-1-[(2S)-2-methyloxiran-2-yl]-3-phenylpropan-1-one;2,2,2-trifluoroacetic acid |
| SMILES | C[C@@]1(C(=O)[C@@H](N)Cc2ccccc2)CO1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C12H15NO2.C2HF3O2/c1-12(8-15-12)11(14)10(13)7-9-5-3-2-4-6-9;3-2(4,5)1(6)7/h2-6,10H,7-8,13H2,1H3;(H,6,7)/t10-,12-;/m0./s1 |
| InChIKey | RNWOEDOEGGNXLY-JGAZGGJJSA-N |
| XLogP | 1.55 |
| TPSA | 92.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.28 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|