C16H20F3NO3 — CID 159767854
(2S)-2-amino-3-(4-ethylphenyl)-1-[(2R)-2-methyloxiran-2-yl]propan-1-one;2,2,2-trifluoroacetaldehyde (PubChem CID 159767854) has the molecular formula C16H20F3NO3 and a molecular weight of 331.33 g/mol. Its IUPAC name is (2S)-2-amino-3-(4-ethylphenyl)-1-[(2R)-2-methyloxiran-2-yl]propan-1-one;2,2,2-trifluoroacetaldehyde.
| Compound Name | (2S)-2-amino-3-(4-ethylphenyl)-1-[(2R)-2-methyloxiran-2-yl]propan-1-one;2,2,2-trifluoroacetaldehyde |
|---|---|
| PubChem CID | 159767854 |
| Molecular Formula | C16H20F3NO3 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | (2S)-2-amino-3-(4-ethylphenyl)-1-[(2R)-2-methyloxiran-2-yl]propan-1-one;2,2,2-trifluoroacetaldehyde |
| SMILES | CCc1ccc(C[C@H](N)C(=O)[C@@]2(C)CO2)cc1.O=CC(F)(F)F |
| InChI | InChI=1S/C14H19NO2.C2HF3O/c1-3-10-4-6-11(7-5-10)8-12(15)13(16)14(2)9-17-14;3-2(4,5)1-6/h4-7,12H,3,8-9,15H2,1-2H3;1H/t12-,14+;/m0./s1 |
| InChIKey | NFSQPCVTWQMUMP-DSHXVJGRSA-N |
| XLogP | 2.22 |
| TPSA | 72.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|