C13H18N2S2 — CID 115693774
1-[(2-methylthiolan-2-yl)methyl]-3-phenylthiourea (PubChem CID 115693774) has the molecular formula C13H18N2S2 and a molecular weight of 266.43 g/mol. Its IUPAC name is 1-[(2-methylthiolan-2-yl)methyl]-3-phenylthiourea.
| Compound Name | 1-[(2-methylthiolan-2-yl)methyl]-3-phenylthiourea |
|---|---|
| PubChem CID | 115693774 |
| Molecular Formula | C13H18N2S2 |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 1-[(2-methylthiolan-2-yl)methyl]-3-phenylthiourea |
| SMILES | CC1(CNC(=S)Nc2ccccc2)CCCS1 |
| InChI | InChI=1S/C13H18N2S2/c1-13(8-5-9-17-13)10-14-12(16)15-11-6-3-2-4-7-11/h2-4,6-7H,5,8-10H2,1H3,(H2,14,15,16) |
| InChIKey | RTCWJIHFJQNSEM-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|