C16H19N3OS — CID 80743131
2-amino-N-[(2-methylthiolan-2-yl)methyl]quinoline-4-carboxamide (PubChem CID 80743131) has the molecular formula C16H19N3OS and a molecular weight of 301.42 g/mol. Its IUPAC name is 2-amino-N-[(2-methylthiolan-2-yl)methyl]quinoline-4-carboxamide.
| Compound Name | 2-amino-N-[(2-methylthiolan-2-yl)methyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 80743131 |
| Molecular Formula | C16H19N3OS |
| Molecular Weight | 301.42 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 2-amino-N-[(2-methylthiolan-2-yl)methyl]quinoline-4-carboxamide |
| SMILES | CC1(CNC(=O)c2cc(N)nc3ccccc23)CCCS1 |
| InChI | InChI=1S/C16H19N3OS/c1-16(7-4-8-21-16)10-18-15(20)12-9-14(17)19-13-6-3-2-5-11(12)13/h2-3,5-6,9H,4,7-8,10H2,1H3,(H2,17,19)(H,18,20) |
| InChIKey | ZJEBGSYDNXHGCL-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.42 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |