C11H15NOS2 — CID 80528767
N-[(2-methylthiolan-2-yl)methyl]thiophene-2-carboxamide (PubChem CID 80528767) has the molecular formula C11H15NOS2 and a molecular weight of 241.38 g/mol. Its IUPAC name is N-[(2-methylthiolan-2-yl)methyl]thiophene-2-carboxamide.
| Compound Name | N-[(2-methylthiolan-2-yl)methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 80528767 |
| Molecular Formula | C11H15NOS2 |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | N-[(2-methylthiolan-2-yl)methyl]thiophene-2-carboxamide |
| SMILES | CC1(CNC(=O)c2cccs2)CCCS1 |
| InChI | InChI=1S/C11H15NOS2/c1-11(5-3-7-15-11)8-12-10(13)9-4-2-6-14-9/h2,4,6H,3,5,7-8H2,1H3,(H,12,13) |
| InChIKey | WWCFLRNINJIHQC-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |