C18H29N3OS — CID 35672039
N-[[1-(4-ethylpiperazin-1-yl)cyclohexyl]methyl]thiophene-2-carboxamide (PubChem CID 35672039) has the molecular formula C18H29N3OS and a molecular weight of 335.52 g/mol. Its IUPAC name is N-[[1-(4-ethylpiperazin-1-yl)cyclohexyl]methyl]thiophene-2-carboxamide.
| Compound Name | N-[[1-(4-ethylpiperazin-1-yl)cyclohexyl]methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 35672039 |
| Molecular Formula | C18H29N3OS |
| Molecular Weight | 335.52 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | N-[[1-(4-ethylpiperazin-1-yl)cyclohexyl]methyl]thiophene-2-carboxamide |
| SMILES | CCN1CCN(C2(CNC(=O)c3cccs3)CCCCC2)CC1 |
| InChI | InChI=1S/C18H29N3OS/c1-2-20-10-12-21(13-11-20)18(8-4-3-5-9-18)15-19-17(22)16-7-6-14-23-16/h6-7,14H,2-5,8-13,15H2,1H3,(H,19,22) |
| InChIKey | CLQRVUASLQFVGE-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.52 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |