C11H22N2S2 — CID 115693770
1-(2-methylpropyl)-3-[(2-methylthiolan-2-yl)methyl]thiourea (PubChem CID 115693770) has the molecular formula C11H22N2S2 and a molecular weight of 246.44 g/mol. Its IUPAC name is 1-(2-methylpropyl)-3-[(2-methylthiolan-2-yl)methyl]thiourea.
| Compound Name | 1-(2-methylpropyl)-3-[(2-methylthiolan-2-yl)methyl]thiourea |
|---|---|
| PubChem CID | 115693770 |
| Molecular Formula | C11H22N2S2 |
| Molecular Weight | 246.44 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 1-(2-methylpropyl)-3-[(2-methylthiolan-2-yl)methyl]thiourea |
| SMILES | CC(C)CNC(=S)NCC1(C)CCCS1 |
| InChI | InChI=1S/C11H22N2S2/c1-9(2)7-12-10(14)13-8-11(3)5-4-6-15-11/h9H,4-8H2,1-3H3,(H2,12,13,14) |
| InChIKey | RTKMLTUGQXHFPS-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.44 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|