C22H38S4 — CID 72737617
2-hex-5-enyl-2-[2-(2-hex-5-enyl-1,3-dithian-2-yl)ethyl]-1,3-dithiane (PubChem CID 72737617) has the molecular formula C22H38S4 and a molecular weight of 430.81 g/mol. Its IUPAC name is 2-hex-5-enyl-2-[2-(2-hex-5-enyl-1,3-dithian-2-yl)ethyl]-1,3-dithiane.
| Compound Name | 2-hex-5-enyl-2-[2-(2-hex-5-enyl-1,3-dithian-2-yl)ethyl]-1,3-dithiane |
|---|---|
| PubChem CID | 72737617 |
| Molecular Formula | C22H38S4 |
| Molecular Weight | 430.81 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | 2-hex-5-enyl-2-[2-(2-hex-5-enyl-1,3-dithian-2-yl)ethyl]-1,3-dithiane |
| SMILES | C=CCCCCC1(CCC2(CCCCC=C)SCCCS2)SCCCS1 |
| InChI | InChI=1S/C22H38S4/c1-3-5-7-9-13-21(23-17-11-18-24-21)15-16-22(14-10-8-6-4-2)25-19-12-20-26-22/h3-4H,1-2,5-20H2 |
| InChIKey | AEAFQGIMSXSKJF-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.81 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|