C18H28O4S2 — CID 23254615
methyl (E)-7-[2-[(E)-5-methoxy-5-oxopent-3-enyl]-1,3-dithian-2-yl]hept-2-enoate (PubChem CID 23254615) has the molecular formula C18H28O4S2 and a molecular weight of 372.55 g/mol. Its IUPAC name is methyl (E)-7-[2-[(E)-5-methoxy-5-oxopent-3-enyl]-1,3-dithian-2-yl]hept-2-enoate.
| Compound Name | methyl (E)-7-[2-[(E)-5-methoxy-5-oxopent-3-enyl]-1,3-dithian-2-yl]hept-2-enoate |
|---|---|
| PubChem CID | 23254615 |
| Molecular Formula | C18H28O4S2 |
| Molecular Weight | 372.55 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | methyl (E)-7-[2-[(E)-5-methoxy-5-oxopent-3-enyl]-1,3-dithian-2-yl]hept-2-enoate |
| SMILES | COC(=O)/C=C/CCCCC1(CC/C=C/C(=O)OC)SCCCS1 |
| InChI | InChI=1S/C18H28O4S2/c1-21-16(19)10-5-3-4-7-12-18(23-14-9-15-24-18)13-8-6-11-17(20)22-2/h5-6,10-11H,3-4,7-9,12-15H2,1-2H3/b10-5+,11-6+ |
| InChIKey | RARAVHUVYPEKEK-YOYBCKCWSA-N |
| XLogP | 4.35 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.55 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|