About methyl (Z)-5-iodopent-2-enoate
methyl (Z)-5-iodopent-2-enoate (PubChem CID 101257877) has the molecular formula C6H9IO2
and a molecular weight of 240.04 g/mol. Its IUPAC name is methyl (Z)-5-iodopent-2-enoate.
Molecular Properties
| Compound Name | methyl (Z)-5-iodopent-2-enoate |
| PubChem CID | 101257877 |
| Molecular Formula | C6H9IO2 |
| Molecular Weight | 240.04 g/mol |
| Exact Mass | 239.96 |
| IUPAC Name | methyl (Z)-5-iodopent-2-enoate |
| SMILES | COC(=O)/C=C\CCI |
| InChI | InChI=1S/C6H9IO2/c1-9-6(8)4-2-3-5-7/h2,4H,3,5H2,1H3/b4-2- |
| InChIKey | LPCUYNIBJJSGBK-RQOWECAXSA-N |
| XLogP | 1.54 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.04 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl (Z)-5-iodopent-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (Z)-5-iodopent-2-enoate?
The IUPAC name of methyl (Z)-5-iodopent-2-enoate (CID 101257877) is methyl (Z)-5-iodopent-2-enoate.
What is the SMILES notation for methyl (Z)-5-iodopent-2-enoate?
The canonical SMILES for methyl (Z)-5-iodopent-2-enoate is COC(=O)/C=C\CCI.
What is the InChIKey of methyl (Z)-5-iodopent-2-enoate?
The InChIKey is LPCUYNIBJJSGBK-RQOWECAXSA-N. The full InChI is InChI=1S/C6H9IO2/c1-9-6(8)4-2-3-5-7/h2,4H,3,5H2,1H3/b4-2-.
What are the key properties of methyl (Z)-5-iodopent-2-enoate?
methyl (Z)-5-iodopent-2-enoate has a molecular weight of 240.04 g/mol, XLogP of 1.54, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (Z)-5-iodopent-2-enoate is sourced from PubChem (CID 101257877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).