C14H24S2 — CID 132538518
2,2-bis(pent-4-enyl)-1,3-dithiane (PubChem CID 132538518) has the molecular formula C14H24S2 and a molecular weight of 256.48 g/mol. Its IUPAC name is 2,2-bis(pent-4-enyl)-1,3-dithiane.
| Compound Name | 2,2-bis(pent-4-enyl)-1,3-dithiane |
|---|---|
| PubChem CID | 132538518 |
| Molecular Formula | C14H24S2 |
| Molecular Weight | 256.48 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 2,2-bis(pent-4-enyl)-1,3-dithiane |
| SMILES | C=CCCCC1(CCCC=C)SCCCS1 |
| InChI | InChI=1S/C14H24S2/c1-3-5-7-10-14(11-8-6-4-2)15-12-9-13-16-14/h3-4H,1-2,5-13H2 |
| InChIKey | XRAODSCKWWHPLM-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.48 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|