C20H40O2S2 — CID 88576345
6-[2-(6-hydroxy-5,5-dimethylhexyl)-1,3-dithian-2-yl]-2,2-dimethylhexan-1-ol (PubChem CID 88576345) has the molecular formula C20H40O2S2 and a molecular weight of 376.67 g/mol. Its IUPAC name is 6-[2-(6-hydroxy-5,5-dimethylhexyl)-1,3-dithian-2-yl]-2,2-dimethylhexan-1-ol.
| Compound Name | 6-[2-(6-hydroxy-5,5-dimethylhexyl)-1,3-dithian-2-yl]-2,2-dimethylhexan-1-ol |
|---|---|
| PubChem CID | 88576345 |
| Molecular Formula | C20H40O2S2 |
| Molecular Weight | 376.67 g/mol |
| Exact Mass | 376.25 |
| IUPAC Name | 6-[2-(6-hydroxy-5,5-dimethylhexyl)-1,3-dithian-2-yl]-2,2-dimethylhexan-1-ol |
| SMILES | CC(C)(CO)CCCCC1(CCCCC(C)(C)CO)SCCCS1 |
| InChI | InChI=1S/C20H40O2S2/c1-18(2,16-21)10-5-7-12-20(23-14-9-15-24-20)13-8-6-11-19(3,4)17-22/h21-22H,5-17H2,1-4H3 |
| InChIKey | WYAWCXORBFSZGJ-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.67 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|