C12H24O2S2 — CID 593950
4-[2-(4-hydroxybutyl)-1,3-dithian-2-yl]butan-2-ol (PubChem CID 593950) has the molecular formula C12H24O2S2 and a molecular weight of 264.46 g/mol. Its IUPAC name is 4-[2-(4-hydroxybutyl)-1,3-dithian-2-yl]butan-2-ol.
| Compound Name | 4-[2-(4-hydroxybutyl)-1,3-dithian-2-yl]butan-2-ol |
|---|---|
| PubChem CID | 593950 |
| Molecular Formula | C12H24O2S2 |
| Molecular Weight | 264.46 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 4-[2-(4-hydroxybutyl)-1,3-dithian-2-yl]butan-2-ol |
| SMILES | CC(O)CCC1(CCCCO)SCCCS1 |
| InChI | InChI=1S/C12H24O2S2/c1-11(14)5-7-12(6-2-3-8-13)15-9-4-10-16-12/h11,13-14H,2-10H2,1H3 |
| InChIKey | FGVVTEJWDYCBQM-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.46 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|