C13H25NO5S2 — CID 101401308
4-[2-[3-(methoxymethoxy)propyl]-1,3-dithian-2-yl]-1-nitrobutan-2-ol (PubChem CID 101401308) has the molecular formula C13H25NO5S2 and a molecular weight of 339.48 g/mol. Its IUPAC name is 4-[2-[3-(methoxymethoxy)propyl]-1,3-dithian-2-yl]-1-nitrobutan-2-ol.
| Compound Name | 4-[2-[3-(methoxymethoxy)propyl]-1,3-dithian-2-yl]-1-nitrobutan-2-ol |
|---|---|
| PubChem CID | 101401308 |
| Molecular Formula | C13H25NO5S2 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 4-[2-[3-(methoxymethoxy)propyl]-1,3-dithian-2-yl]-1-nitrobutan-2-ol |
| SMILES | COCOCCCC1(CCC(O)C[N+](=O)[O-])SCCCS1 |
| InChI | InChI=1S/C13H25NO5S2/c1-18-11-19-7-2-5-13(20-8-3-9-21-13)6-4-12(15)10-14(16)17/h12,15H,2-11H2,1H3 |
| InChIKey | UTKBKGNNFIUKMB-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|