About 1-nitrotetradecan-2-ol
1-nitrotetradecan-2-ol (PubChem CID 21398670) has the molecular formula C14H29NO3
and a molecular weight of 259.39 g/mol. Its IUPAC name is 1-nitrotetradecan-2-ol.
Molecular Properties
| Compound Name | 1-nitrotetradecan-2-ol |
| PubChem CID | 21398670 |
| Molecular Formula | C14H29NO3 |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.21 |
| IUPAC Name | 1-nitrotetradecan-2-ol |
| SMILES | CCCCCCCCCCCCC(O)C[N+](=O)[O-] |
| InChI | InChI=1S/C14H29NO3/c1-2-3-4-5-6-7-8-9-10-11-12-14(16)13-15(17)18/h14,16H,2-13H2,1H3 |
| InChIKey | ZZLLZPMIXXORKL-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-nitrotetradecan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-nitrotetradecan-2-ol?
The IUPAC name of 1-nitrotetradecan-2-ol (CID 21398670) is 1-nitrotetradecan-2-ol.
What is the SMILES notation for 1-nitrotetradecan-2-ol?
The canonical SMILES for 1-nitrotetradecan-2-ol is CCCCCCCCCCCCC(O)C[N+](=O)[O-].
What is the InChIKey of 1-nitrotetradecan-2-ol?
The InChIKey is ZZLLZPMIXXORKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H29NO3/c1-2-3-4-5-6-7-8-9-10-11-12-14(16)13-15(17)18/h14,16H,2-13H2,1H3.
What are the key properties of 1-nitrotetradecan-2-ol?
1-nitrotetradecan-2-ol has a molecular weight of 259.39 g/mol, XLogP of 3.93, 13 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-nitrotetradecan-2-ol is sourced from PubChem (CID 21398670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).