C9H20O6 — CID 71369037
4-[3-(methoxymethoxy)propoxy]butane-1,2,3-triol (PubChem CID 71369037) has the molecular formula C9H20O6 and a molecular weight of 224.25 g/mol. Its IUPAC name is 4-[3-(methoxymethoxy)propoxy]butane-1,2,3-triol.
| Compound Name | 4-[3-(methoxymethoxy)propoxy]butane-1,2,3-triol |
|---|---|
| PubChem CID | 71369037 |
| Molecular Formula | C9H20O6 |
| Molecular Weight | 224.25 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 4-[3-(methoxymethoxy)propoxy]butane-1,2,3-triol |
| SMILES | COCOCCCOCC(O)C(O)CO |
| InChI | InChI=1S/C9H20O6/c1-13-7-15-4-2-3-14-6-9(12)8(11)5-10/h8-12H,2-7H2,1H3 |
| InChIKey | JOFSSNITBRCVFT-UHFFFAOYSA-N |
| XLogP | -1.27 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.25 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|