C11H25NO7 — CID 122500925
(2R,3S)-4-[2-methoxyethyl-[(2S,3R)-2,3,4-trihydroxybutyl]amino]butane-1,2,3-triol (PubChem CID 122500925) has the molecular formula C11H25NO7 and a molecular weight of 283.32 g/mol. Its IUPAC name is (2R,3S)-4-[2-methoxyethyl-[(2S,3R)-2,3,4-trihydroxybutyl]amino]butane-1,2,3-triol.
| Compound Name | (2R,3S)-4-[2-methoxyethyl-[(2S,3R)-2,3,4-trihydroxybutyl]amino]butane-1,2,3-triol |
|---|---|
| PubChem CID | 122500925 |
| Molecular Formula | C11H25NO7 |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | (2R,3S)-4-[2-methoxyethyl-[(2S,3R)-2,3,4-trihydroxybutyl]amino]butane-1,2,3-triol |
| SMILES | COCCN(C[C@H](O)[C@H](O)CO)C[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C11H25NO7/c1-19-3-2-12(4-8(15)10(17)6-13)5-9(16)11(18)7-14/h8-11,13-18H,2-7H2,1H3/t8-,9-,10+,11+/m0/s1 |
| InChIKey | MBNCHWGHUYYANQ-UKKRHICBSA-N |
| XLogP | -3.64 |
| TPSA | 133.85 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | -3.64 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |