C17H36O6S — CID 101466075
(2R,3R,4R,5S)-6-(11-sulfanylundecoxy)hexane-1,2,3,4,5-pentol (PubChem CID 101466075) has the molecular formula C17H36O6S and a molecular weight of 368.54 g/mol. Its IUPAC name is (2R,3R,4R,5S)-6-(11-sulfanylundecoxy)hexane-1,2,3,4,5-pentol.
| Compound Name | (2R,3R,4R,5S)-6-(11-sulfanylundecoxy)hexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 101466075 |
| Molecular Formula | C17H36O6S |
| Molecular Weight | 368.54 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | (2R,3R,4R,5S)-6-(11-sulfanylundecoxy)hexane-1,2,3,4,5-pentol |
| SMILES | OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)COCCCCCCCCCCCS |
| InChI | InChI=1S/C17H36O6S/c18-12-14(19)16(21)17(22)15(20)13-23-10-8-6-4-2-1-3-5-7-9-11-24/h14-22,24H,1-13H2/t14-,15+,16-,17-/m1/s1 |
| InChIKey | MLJPUBMVQUVUHI-YYIAUSFCSA-N |
| XLogP | 0.88 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.54 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|