C22H40Na2O14 — CID 175283783
disodium;3-carboxy-3-hydroxypentanedioate;6-(10-hydroxydecoxy)hexane-1,2,3,4,5-pentol (PubChem CID 175283783) has the molecular formula C22H40Na2O14 and a molecular weight of 574.53 g/mol. Its IUPAC name is disodium;3-carboxy-3-hydroxypentanedioate;6-(10-hydroxydecoxy)hexane-1,2,3,4,5-pentol.
| Compound Name | disodium;3-carboxy-3-hydroxypentanedioate;6-(10-hydroxydecoxy)hexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 175283783 |
| Molecular Formula | C22H40Na2O14 |
| Molecular Weight | 574.53 g/mol |
| Exact Mass | 574.22 |
| IUPAC Name | disodium;3-carboxy-3-hydroxypentanedioate;6-(10-hydroxydecoxy)hexane-1,2,3,4,5-pentol |
| SMILES | O=C([O-])CC(O)(CC(=O)[O-])C(=O)O.OCCCCCCCCCCOCC(O)C(O)C(O)C(O)CO.[Na+].[Na+] |
| InChI | InChI=1S/C16H34O7.C6H8O7.2Na/c17-9-7-5-3-1-2-4-6-8-10-23-12-14(20)16(22)15(21)13(19)11-18;7-3(8)1-6(13,5(11)12)2-4(9)10;;/h13-22H,1-12H2;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);;/q;;2*+1/p-2 |
| InChIKey | PFQZRKTYHJQFRU-UHFFFAOYSA-L |
| XLogP | -10.36 |
| TPSA | 268.40 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.53 |
| LogP ≤ 5 | -10.36 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|