C24H46O8 — CID 91112144
18-[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexoxy]octadec-9-enoic acid (PubChem CID 91112144) has the molecular formula C24H46O8 and a molecular weight of 462.62 g/mol. Its IUPAC name is 18-[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexoxy]octadec-9-enoic acid.
| Compound Name | 18-[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexoxy]octadec-9-enoic acid |
|---|---|
| PubChem CID | 91112144 |
| Molecular Formula | C24H46O8 |
| Molecular Weight | 462.62 g/mol |
| Exact Mass | 462.32 |
| IUPAC Name | 18-[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexoxy]octadec-9-enoic acid |
| SMILES | O=C(O)CCCCCCCC=CCCCCCCCCOC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C24H46O8/c25-18-20(26)23(30)24(31)21(27)19-32-17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-22(28)29/h1-2,20-21,23-27,30-31H,3-19H2,(H,28,29)/t20-,21-,23-,24-/m1/s1 |
| InChIKey | HOJNKKNUKUOGFK-LUGTWXOSSA-N |
| XLogP | 2.54 |
| TPSA | 147.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.62 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|