C9H17NO6 — CID 20747913
3-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexoxy]propanenitrile (PubChem CID 20747913) has the molecular formula C9H17NO6 and a molecular weight of 235.24 g/mol. Its IUPAC name is 3-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexoxy]propanenitrile.
| Compound Name | 3-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexoxy]propanenitrile |
|---|---|
| PubChem CID | 20747913 |
| Molecular Formula | C9H17NO6 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | 3-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexoxy]propanenitrile |
| SMILES | N#CCCOC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C9H17NO6/c10-2-1-3-16-5-7(13)9(15)8(14)6(12)4-11/h6-9,11-15H,1,3-5H2/t6-,7+,8-,9-/m1/s1 |
| InChIKey | GNMOTQQCGUGHHT-BZNPZCIMSA-N |
| XLogP | -2.65 |
| TPSA | 134.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | -2.65 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|