C16H29NO13 — CID 173012623
acetic acid;3-[(2R,3R,4S)-2,3,4-trihydroxy-5-oxopentoxy]propanenitrile (PubChem CID 173012623) has the molecular formula C16H29NO13 and a molecular weight of 443.40 g/mol. Its IUPAC name is acetic acid;3-[(2R,3R,4S)-2,3,4-trihydroxy-5-oxopentoxy]propanenitrile.
| Compound Name | acetic acid;3-[(2R,3R,4S)-2,3,4-trihydroxy-5-oxopentoxy]propanenitrile |
|---|---|
| PubChem CID | 173012623 |
| Molecular Formula | C16H29NO13 |
| Molecular Weight | 443.40 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | acetic acid;3-[(2R,3R,4S)-2,3,4-trihydroxy-5-oxopentoxy]propanenitrile |
| SMILES | CC(=O)O.CC(=O)O.CC(=O)O.CC(=O)O.N#CCCOC[C@@H](O)[C@@H](O)[C@H](O)C=O |
| InChI | InChI=1S/C8H13NO5.4C2H4O2/c9-2-1-3-14-5-7(12)8(13)6(11)4-10;4*1-2(3)4/h4,6-8,11-13H,1,3,5H2;4*1H3,(H,3,4)/t6-,7-,8+;;;;/m1..../s1 |
| InChIKey | XEGVWXIBLMUAJJ-VGHDQRMLSA-N |
| XLogP | -1.44 |
| TPSA | 259.98 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.40 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|