C11H20N2O6 — CID 110181615
3-[2-hydroxy-3-(propan-2-ylamino)propoxy]propanenitrile;oxalic acid (PubChem CID 110181615) has the molecular formula C11H20N2O6 and a molecular weight of 276.29 g/mol. Its IUPAC name is 3-[2-hydroxy-3-(propan-2-ylamino)propoxy]propanenitrile;oxalic acid.
| Compound Name | 3-[2-hydroxy-3-(propan-2-ylamino)propoxy]propanenitrile;oxalic acid |
|---|---|
| PubChem CID | 110181615 |
| Molecular Formula | C11H20N2O6 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 3-[2-hydroxy-3-(propan-2-ylamino)propoxy]propanenitrile;oxalic acid |
| SMILES | CC(C)NCC(O)COCCC#N.O=C(O)C(=O)O |
| InChI | InChI=1S/C9H18N2O2.C2H2O4/c1-8(2)11-6-9(12)7-13-5-3-4-10;3-1(4)2(5)6/h8-9,11-12H,3,5-7H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | CARUBCACZULORE-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 139.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|