C14H24N2O6 — CID 110181617
(E)-but-2-enedioic acid;3-[3-(tert-butylamino)-2-hydroxypropoxy]propanenitrile (PubChem CID 110181617) has the molecular formula C14H24N2O6 and a molecular weight of 316.35 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;3-[3-(tert-butylamino)-2-hydroxypropoxy]propanenitrile.
| Compound Name | (E)-but-2-enedioic acid;3-[3-(tert-butylamino)-2-hydroxypropoxy]propanenitrile |
|---|---|
| PubChem CID | 110181617 |
| Molecular Formula | C14H24N2O6 |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | (E)-but-2-enedioic acid;3-[3-(tert-butylamino)-2-hydroxypropoxy]propanenitrile |
| SMILES | CC(C)(C)NCC(O)COCCC#N.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C10H20N2O2.C4H4O4/c1-10(2,3)12-7-9(13)8-14-6-4-5-11;5-3(6)1-2-4(7)8/h9,12-13H,4,6-8H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | XAGBEBBZPJDYCY-WLHGVMLRSA-N |
| XLogP | 0.38 |
| TPSA | 139.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|