C14H29NO6 — CID 110181826
1-(tert-butylamino)-3-(2,2-dimethylpropoxy)propan-2-ol;oxalic acid (PubChem CID 110181826) has the molecular formula C14H29NO6 and a molecular weight of 307.39 g/mol. Its IUPAC name is 1-(tert-butylamino)-3-(2,2-dimethylpropoxy)propan-2-ol;oxalic acid.
| Compound Name | 1-(tert-butylamino)-3-(2,2-dimethylpropoxy)propan-2-ol;oxalic acid |
|---|---|
| PubChem CID | 110181826 |
| Molecular Formula | C14H29NO6 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | 1-(tert-butylamino)-3-(2,2-dimethylpropoxy)propan-2-ol;oxalic acid |
| SMILES | CC(C)(C)COCC(O)CNC(C)(C)C.O=C(O)C(=O)O |
| InChI | InChI=1S/C12H27NO2.C2H2O4/c1-11(2,3)9-15-8-10(14)7-13-12(4,5)6;3-1(4)2(5)6/h10,13-14H,7-9H2,1-6H3;(H,3,4)(H,5,6) |
| InChIKey | DEVUNMKWMRFKFM-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|