C19H27N3O6 — CID 12919762
(Z)-but-2-enedioic acid;2-[(2S)-3-(tert-butylamino)-2-hydroxypropoxy]-4,5-dimethylpyridine-3-carbonitrile (PubChem CID 12919762) has the molecular formula C19H27N3O6 and a molecular weight of 393.44 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;2-[(2S)-3-(tert-butylamino)-2-hydroxypropoxy]-4,5-dimethylpyridine-3-carbonitrile.
| Compound Name | (Z)-but-2-enedioic acid;2-[(2S)-3-(tert-butylamino)-2-hydroxypropoxy]-4,5-dimethylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 12919762 |
| Molecular Formula | C19H27N3O6 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | (Z)-but-2-enedioic acid;2-[(2S)-3-(tert-butylamino)-2-hydroxypropoxy]-4,5-dimethylpyridine-3-carbonitrile |
| SMILES | Cc1cnc(OC[C@@H](O)CNC(C)(C)C)c(C#N)c1C.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C15H23N3O2.C4H4O4/c1-10-7-17-14(13(6-16)11(10)2)20-9-12(19)8-18-15(3,4)5;5-3(6)1-2-4(7)8/h7,12,18-19H,8-9H2,1-5H3;1-2H,(H,5,6)(H,7,8)/b;2-1-/t12-;/m0./s1 |
| InChIKey | IGVAIDLXZGJHNQ-OURKGEEVSA-N |
| XLogP | 1.41 |
| TPSA | 152.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|