C20H31NO7 — CID 70360449
(Z)-but-2-enedioic acid;(2S)-1-(tert-butylamino)-3-[2-(2-hydroxyethyl)-4-methylphenoxy]propan-2-ol (PubChem CID 70360449) has the molecular formula C20H31NO7 and a molecular weight of 397.47 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;(2S)-1-(tert-butylamino)-3-[2-(2-hydroxyethyl)-4-methylphenoxy]propan-2-ol.
| Compound Name | (Z)-but-2-enedioic acid;(2S)-1-(tert-butylamino)-3-[2-(2-hydroxyethyl)-4-methylphenoxy]propan-2-ol |
|---|---|
| PubChem CID | 70360449 |
| Molecular Formula | C20H31NO7 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | (Z)-but-2-enedioic acid;(2S)-1-(tert-butylamino)-3-[2-(2-hydroxyethyl)-4-methylphenoxy]propan-2-ol |
| SMILES | Cc1ccc(OC[C@@H](O)CNC(C)(C)C)c(CCO)c1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C16H27NO3.C4H4O4/c1-12-5-6-15(13(9-12)7-8-18)20-11-14(19)10-17-16(2,3)4;5-3(6)1-2-4(7)8/h5-6,9,14,17-19H,7-8,10-11H2,1-4H3;1-2H,(H,5,6)(H,7,8)/b;2-1-/t14-;/m0./s1 |
| InChIKey | YIDBCRZBKPJPAK-FXSDFHGDSA-N |
| XLogP | 1.37 |
| TPSA | 136.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|