C20H27N3O6 — CID 160617953
(Z)-but-2-enedioic acid;(2S)-1-(tert-butylamino)-3-[(3-pyrrol-1-yl-2-pyridinyl)oxy]propan-2-ol (PubChem CID 160617953) has the molecular formula C20H27N3O6 and a molecular weight of 405.45 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;(2S)-1-(tert-butylamino)-3-[(3-pyrrol-1-yl-2-pyridinyl)oxy]propan-2-ol.
| Compound Name | (Z)-but-2-enedioic acid;(2S)-1-(tert-butylamino)-3-[(3-pyrrol-1-yl-2-pyridinyl)oxy]propan-2-ol |
|---|---|
| PubChem CID | 160617953 |
| Molecular Formula | C20H27N3O6 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | (Z)-but-2-enedioic acid;(2S)-1-(tert-butylamino)-3-[(3-pyrrol-1-yl-2-pyridinyl)oxy]propan-2-ol |
| SMILES | CC(C)(C)NC[C@H](O)COc1ncccc1-n1cccc1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C16H23N3O2.C4H4O4/c1-16(2,3)18-11-13(20)12-21-15-14(7-6-8-17-15)19-9-4-5-10-19;5-3(6)1-2-4(7)8/h4-10,13,18,20H,11-12H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b;2-1-/t13-;/m0./s1 |
| InChIKey | RGIIOJAZIATNDP-FTUYNFQWSA-N |
| XLogP | 1.71 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|