C24H32N4O8S — CID 45267146
(Z)-but-2-enedioic acid;[(2S)-1-(tert-butylamino)-3-[(4-morpholin-4-yl-1,2,5-thiadiazol-3-yl)oxy]propan-2-yl] benzoate (PubChem CID 45267146) has the molecular formula C24H32N4O8S and a molecular weight of 536.61 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;[(2S)-1-(tert-butylamino)-3-[(4-morpholin-4-yl-1,2,5-thiadiazol-3-yl)oxy]propan-2-yl] benzoate.
| Compound Name | (Z)-but-2-enedioic acid;[(2S)-1-(tert-butylamino)-3-[(4-morpholin-4-yl-1,2,5-thiadiazol-3-yl)oxy]propan-2-yl] benzoate |
|---|---|
| PubChem CID | 45267146 |
| Molecular Formula | C24H32N4O8S |
| Molecular Weight | 536.61 g/mol |
| Exact Mass | 536.19 |
| IUPAC Name | (Z)-but-2-enedioic acid;[(2S)-1-(tert-butylamino)-3-[(4-morpholin-4-yl-1,2,5-thiadiazol-3-yl)oxy]propan-2-yl] benzoate |
| SMILES | CC(C)(C)NC[C@@H](COc1nsnc1N1CCOCC1)OC(=O)c1ccccc1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C20H28N4O4S.C4H4O4/c1-20(2,3)21-13-16(28-19(25)15-7-5-4-6-8-15)14-27-18-17(22-29-23-18)24-9-11-26-12-10-24;5-3(6)1-2-4(7)8/h4-8,16,21H,9-14H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b;2-1-/t16-;/m0./s1 |
| InChIKey | DMFPCZJODYIBQR-ZSJYYTRTSA-N |
| XLogP | 2.08 |
| TPSA | 160.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.61 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|