C17H23Cl2N3O7 — CID 159281346
(Z)-but-2-enedioic acid;N-[3-(tert-butylamino)-2-hydroxypropoxy]-N,2-dichloropyridine-3-carboxamide (PubChem CID 159281346) has the molecular formula C17H23Cl2N3O7 and a molecular weight of 452.29 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;N-[3-(tert-butylamino)-2-hydroxypropoxy]-N,2-dichloropyridine-3-carboxamide.
| Compound Name | (Z)-but-2-enedioic acid;N-[3-(tert-butylamino)-2-hydroxypropoxy]-N,2-dichloropyridine-3-carboxamide |
|---|---|
| PubChem CID | 159281346 |
| Molecular Formula | C17H23Cl2N3O7 |
| Molecular Weight | 452.29 g/mol |
| Exact Mass | 451.09 |
| IUPAC Name | (Z)-but-2-enedioic acid;N-[3-(tert-butylamino)-2-hydroxypropoxy]-N,2-dichloropyridine-3-carboxamide |
| SMILES | CC(C)(C)NCC(O)CON(Cl)C(=O)c1cccnc1Cl.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C13H19Cl2N3O3.C4H4O4/c1-13(2,3)17-7-9(19)8-21-18(15)12(20)10-5-4-6-16-11(10)14;5-3(6)1-2-4(7)8/h4-6,9,17,19H,7-8H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | KYYNMJKXDWNBIX-BTJKTKAUSA-N |
| XLogP | 1.72 |
| TPSA | 149.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.29 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|