C22H34N2O6 — CID 90679595
(Z)-but-2-enedioic acid;1-(tert-butylamino)-3-[(E)-1-(4-propan-2-ylphenyl)ethylideneamino]oxypropan-2-ol (PubChem CID 90679595) has the molecular formula C22H34N2O6 and a molecular weight of 422.52 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;1-(tert-butylamino)-3-[(E)-1-(4-propan-2-ylphenyl)ethylideneamino]oxypropan-2-ol.
| Compound Name | (Z)-but-2-enedioic acid;1-(tert-butylamino)-3-[(E)-1-(4-propan-2-ylphenyl)ethylideneamino]oxypropan-2-ol |
|---|---|
| PubChem CID | 90679595 |
| Molecular Formula | C22H34N2O6 |
| Molecular Weight | 422.52 g/mol |
| Exact Mass | 422.24 |
| IUPAC Name | (Z)-but-2-enedioic acid;1-(tert-butylamino)-3-[(E)-1-(4-propan-2-ylphenyl)ethylideneamino]oxypropan-2-ol |
| SMILES | C/C(=N\OCC(O)CNC(C)(C)C)c1ccc(C(C)C)cc1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C18H30N2O2.C4H4O4/c1-13(2)15-7-9-16(10-8-15)14(3)20-22-12-17(21)11-19-18(4,5)6;5-3(6)1-2-4(7)8/h7-10,13,17,19,21H,11-12H2,1-6H3;1-2H,(H,5,6)(H,7,8)/b20-14+;2-1- |
| InChIKey | IAAFWZMVTFZBDR-PIDGMYBPSA-N |
| XLogP | 3.01 |
| TPSA | 128.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.52 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|