C17H26N2O5 — CID 11782719
[3-(tert-butylamino)-2-hydroxypropyl] 4-(ethoxycarbonylamino)benzoate (PubChem CID 11782719) has the molecular formula C17H26N2O5 and a molecular weight of 338.40 g/mol. Its IUPAC name is [3-(tert-butylamino)-2-hydroxypropyl] 4-(ethoxycarbonylamino)benzoate.
| Compound Name | [3-(tert-butylamino)-2-hydroxypropyl] 4-(ethoxycarbonylamino)benzoate |
|---|---|
| PubChem CID | 11782719 |
| Molecular Formula | C17H26N2O5 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | [3-(tert-butylamino)-2-hydroxypropyl] 4-(ethoxycarbonylamino)benzoate |
| SMILES | CCOC(=O)Nc1ccc(C(=O)OCC(O)CNC(C)(C)C)cc1 |
| InChI | InChI=1S/C17H26N2O5/c1-5-23-16(22)19-13-8-6-12(7-9-13)15(21)24-11-14(20)10-18-17(2,3)4/h6-9,14,18,20H,5,10-11H2,1-4H3,(H,19,22) |
| InChIKey | ZAVLWQQAXWRUOQ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |