C16H27ClN2O4 — CID 15566893
ethyl N-[2-[3-(tert-butylamino)-2-hydroxypropoxy]phenyl]carbamate;hydrochloride (PubChem CID 15566893) has the molecular formula C16H27ClN2O4 and a molecular weight of 346.86 g/mol. Its IUPAC name is ethyl N-[2-[3-(tert-butylamino)-2-hydroxypropoxy]phenyl]carbamate;hydrochloride.
| Compound Name | ethyl N-[2-[3-(tert-butylamino)-2-hydroxypropoxy]phenyl]carbamate;hydrochloride |
|---|---|
| PubChem CID | 15566893 |
| Molecular Formula | C16H27ClN2O4 |
| Molecular Weight | 346.86 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | ethyl N-[2-[3-(tert-butylamino)-2-hydroxypropoxy]phenyl]carbamate;hydrochloride |
| SMILES | CCOC(=O)Nc1ccccc1OCC(O)CNC(C)(C)C.Cl |
| InChI | InChI=1S/C16H26N2O4.ClH/c1-5-21-15(20)18-13-8-6-7-9-14(13)22-11-12(19)10-17-16(2,3)4;/h6-9,12,17,19H,5,10-11H2,1-4H3,(H,18,20);1H |
| InChIKey | GXIMLHZYGZLNNA-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.86 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |