C16H26N2O4 — CID 15170071
butyl N-[2-[3-(ethylamino)-2-hydroxypropoxy]phenyl]carbamate (PubChem CID 15170071) has the molecular formula C16H26N2O4 and a molecular weight of 310.39 g/mol. Its IUPAC name is butyl N-[2-[3-(ethylamino)-2-hydroxypropoxy]phenyl]carbamate.
| Compound Name | butyl N-[2-[3-(ethylamino)-2-hydroxypropoxy]phenyl]carbamate |
|---|---|
| PubChem CID | 15170071 |
| Molecular Formula | C16H26N2O4 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | butyl N-[2-[3-(ethylamino)-2-hydroxypropoxy]phenyl]carbamate |
| SMILES | CCCCOC(=O)Nc1ccccc1OCC(O)CNCC |
| InChI | InChI=1S/C16H26N2O4/c1-3-5-10-21-16(20)18-14-8-6-7-9-15(14)22-12-13(19)11-17-4-2/h6-9,13,17,19H,3-5,10-12H2,1-2H3,(H,18,20) |
| InChIKey | OXYINPCKIBZSCF-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|