C13H17N3O6 — CID 70810353
ethyl 4-[2-(hydrazinecarbonyloxy)ethoxycarbonylamino]benzoate (PubChem CID 70810353) has the molecular formula C13H17N3O6 and a molecular weight of 311.29 g/mol. Its IUPAC name is ethyl 4-[2-(hydrazinecarbonyloxy)ethoxycarbonylamino]benzoate.
| Compound Name | ethyl 4-[2-(hydrazinecarbonyloxy)ethoxycarbonylamino]benzoate |
|---|---|
| PubChem CID | 70810353 |
| Molecular Formula | C13H17N3O6 |
| Molecular Weight | 311.29 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | ethyl 4-[2-(hydrazinecarbonyloxy)ethoxycarbonylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)OCCOC(=O)NN)cc1 |
| InChI | InChI=1S/C13H17N3O6/c1-2-20-11(17)9-3-5-10(6-4-9)15-12(18)21-7-8-22-13(19)16-14/h3-6H,2,7-8,14H2,1H3,(H,15,18)(H,16,19) |
| InChIKey | ARWOCVHBDLUSBM-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 128.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.29 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|