C16H20N2O7 — CID 5025785
ethyl 4-[2-[(2-ethoxy-2-oxoacetyl)amino]ethoxycarbonylamino]benzoate (PubChem CID 5025785) has the molecular formula C16H20N2O7 and a molecular weight of 352.34 g/mol. Its IUPAC name is ethyl 4-[2-[(2-ethoxy-2-oxoacetyl)amino]ethoxycarbonylamino]benzoate.
| Compound Name | ethyl 4-[2-[(2-ethoxy-2-oxoacetyl)amino]ethoxycarbonylamino]benzoate |
|---|---|
| PubChem CID | 5025785 |
| Molecular Formula | C16H20N2O7 |
| Molecular Weight | 352.34 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | ethyl 4-[2-[(2-ethoxy-2-oxoacetyl)amino]ethoxycarbonylamino]benzoate |
| SMILES | CCOC(=O)C(=O)NCCOC(=O)Nc1ccc(C(=O)OCC)cc1 |
| InChI | InChI=1S/C16H20N2O7/c1-3-23-14(20)11-5-7-12(8-6-11)18-16(22)25-10-9-17-13(19)15(21)24-4-2/h5-8H,3-4,9-10H2,1-2H3,(H,17,19)(H,18,22) |
| InChIKey | LUKVLHNWKWBYSO-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.34 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|