C42H66N2O12 — CID 24832569
(E)-but-2-enedioic acid;bis(1-[4-[3-(tert-butylamino)-2-hydroxypropoxy]-3-(propan-2-yloxymethyl)phenyl]ethanone) (PubChem CID 24832569) has the molecular formula C42H66N2O12 and a molecular weight of 790.99 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;bis(1-[4-[3-(tert-butylamino)-2-hydroxypropoxy]-3-(propan-2-yloxymethyl)phenyl]ethanone).
| Compound Name | (E)-but-2-enedioic acid;bis(1-[4-[3-(tert-butylamino)-2-hydroxypropoxy]-3-(propan-2-yloxymethyl)phenyl]ethanone) |
|---|---|
| PubChem CID | 24832569 |
| Molecular Formula | C42H66N2O12 |
| Molecular Weight | 790.99 g/mol |
| Exact Mass | 790.46 |
| IUPAC Name | (E)-but-2-enedioic acid;bis(1-[4-[3-(tert-butylamino)-2-hydroxypropoxy]-3-(propan-2-yloxymethyl)phenyl]ethanone) |
| SMILES | CC(=O)c1ccc(OCC(O)CNC(C)(C)C)c(COC(C)C)c1.CC(=O)c1ccc(OCC(O)CNC(C)(C)C)c(COC(C)C)c1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/2C19H31NO4.C4H4O4/c2*1-13(2)23-11-16-9-15(14(3)21)7-8-18(16)24-12-17(22)10-20-19(4,5)6;5-3(6)1-2-4(7)8/h2*7-9,13,17,20,22H,10-12H2,1-6H3;1-2H,(H,5,6)(H,7,8)/b;;2-1+ |
| InChIKey | GVDPLRWFUXNWSA-WXXKFALUSA-N |
| XLogP | 5.60 |
| TPSA | 210.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 56 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.99 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|