C9H20O6 — CID 175479329
(2R,3S)-4-(3,5-dihydroxypentoxy)butane-1,2,3-triol (PubChem CID 175479329) has the molecular formula C9H20O6 and a molecular weight of 224.25 g/mol. Its IUPAC name is (2R,3S)-4-(3,5-dihydroxypentoxy)butane-1,2,3-triol.
| Compound Name | (2R,3S)-4-(3,5-dihydroxypentoxy)butane-1,2,3-triol |
|---|---|
| PubChem CID | 175479329 |
| Molecular Formula | C9H20O6 |
| Molecular Weight | 224.25 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | (2R,3S)-4-(3,5-dihydroxypentoxy)butane-1,2,3-triol |
| SMILES | OCCC(O)CCOC[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C9H20O6/c10-3-1-7(12)2-4-15-6-9(14)8(13)5-11/h7-14H,1-6H2/t7?,8-,9+/m1/s1 |
| InChIKey | KVVXNMVBJDHPDC-ASODMVGOSA-N |
| XLogP | -2.15 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.25 |
| LogP ≤ 5 | -2.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|