C8H17ClO4 — CID 163197474
(3S)-4-[(3S)-4-chloro-3-hydroxybutoxy]butane-1,3-diol (PubChem CID 163197474) has the molecular formula C8H17ClO4 and a molecular weight of 212.67 g/mol. Its IUPAC name is (3S)-4-[(3S)-4-chloro-3-hydroxybutoxy]butane-1,3-diol.
| Compound Name | (3S)-4-[(3S)-4-chloro-3-hydroxybutoxy]butane-1,3-diol |
|---|---|
| PubChem CID | 163197474 |
| Molecular Formula | C8H17ClO4 |
| Molecular Weight | 212.67 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | (3S)-4-[(3S)-4-chloro-3-hydroxybutoxy]butane-1,3-diol |
| SMILES | OCC[C@H](O)COCC[C@H](O)CCl |
| InChI | InChI=1S/C8H17ClO4/c9-5-7(11)2-4-13-6-8(12)1-3-10/h7-8,10-12H,1-6H2/t7-,8-/m0/s1 |
| InChIKey | PBKBEDMONRKXTA-YUMQZZPRSA-N |
| XLogP | -0.26 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.67 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|