C12H24Br2O3 — CID 139648584
1,4-bis(4-bromobutoxy)butan-2-ol (PubChem CID 139648584) has the molecular formula C12H24Br2O3 and a molecular weight of 376.13 g/mol. Its IUPAC name is 1,4-bis(4-bromobutoxy)butan-2-ol.
| Compound Name | 1,4-bis(4-bromobutoxy)butan-2-ol |
|---|---|
| PubChem CID | 139648584 |
| Molecular Formula | C12H24Br2O3 |
| Molecular Weight | 376.13 g/mol |
| Exact Mass | 374.01 |
| IUPAC Name | 1,4-bis(4-bromobutoxy)butan-2-ol |
| SMILES | OC(CCOCCCCBr)COCCCCBr |
| InChI | InChI=1S/C12H24Br2O3/c13-6-1-3-8-16-10-5-12(15)11-17-9-4-2-7-14/h12,15H,1-11H2 |
| InChIKey | IBBARFKOZWOFFS-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.13 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|