About 1-bromo-4-(2,3-dibromopropoxy)butane
1-bromo-4-(2,3-dibromopropoxy)butane (PubChem CID 139648605) has the molecular formula C7H13Br3O
and a molecular weight of 352.89 g/mol. Its IUPAC name is 1-bromo-4-(2,3-dibromopropoxy)butane.
Molecular Properties
| Compound Name | 1-bromo-4-(2,3-dibromopropoxy)butane |
| PubChem CID | 139648605 |
| Molecular Formula | C7H13Br3O |
| Molecular Weight | 352.89 g/mol |
| Exact Mass | 349.85 |
| IUPAC Name | 1-bromo-4-(2,3-dibromopropoxy)butane |
| SMILES | BrCCCCOCC(Br)CBr |
| InChI | InChI=1S/C7H13Br3O/c8-3-1-2-4-11-6-7(10)5-9/h7H,1-6H2 |
| InChIKey | WISCNTYLKGHVDO-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.89 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-4-(2,3-dibromopropoxy)butane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-4-(2,3-dibromopropoxy)butane?
The IUPAC name of 1-bromo-4-(2,3-dibromopropoxy)butane (CID 139648605) is 1-bromo-4-(2,3-dibromopropoxy)butane.
What is the SMILES notation for 1-bromo-4-(2,3-dibromopropoxy)butane?
The canonical SMILES for 1-bromo-4-(2,3-dibromopropoxy)butane is BrCCCCOCC(Br)CBr.
What is the InChIKey of 1-bromo-4-(2,3-dibromopropoxy)butane?
The InChIKey is WISCNTYLKGHVDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13Br3O/c8-3-1-2-4-11-6-7(10)5-9/h7H,1-6H2.
What are the key properties of 1-bromo-4-(2,3-dibromopropoxy)butane?
1-bromo-4-(2,3-dibromopropoxy)butane has a molecular weight of 352.89 g/mol, XLogP of 3.34, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-4-(2,3-dibromopropoxy)butane is sourced from PubChem (CID 139648605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).