C8H14Br4O2 — CID 154093304
1,2-dibromo-3-[2-(2,3-dibromopropoxy)ethoxy]propane (PubChem CID 154093304) has the molecular formula C8H14Br4O2 and a molecular weight of 461.81 g/mol. Its IUPAC name is 1,2-dibromo-3-[2-(2,3-dibromopropoxy)ethoxy]propane.
| Compound Name | 1,2-dibromo-3-[2-(2,3-dibromopropoxy)ethoxy]propane |
|---|---|
| PubChem CID | 154093304 |
| Molecular Formula | C8H14Br4O2 |
| Molecular Weight | 461.81 g/mol |
| Exact Mass | 457.77 |
| IUPAC Name | 1,2-dibromo-3-[2-(2,3-dibromopropoxy)ethoxy]propane |
| SMILES | BrCC(Br)COCCOCC(Br)CBr |
| InChI | InChI=1S/C8H14Br4O2/c9-3-7(11)5-13-1-2-14-6-8(12)4-10/h7-8H,1-6H2 |
| InChIKey | BYACMCWRYJMGKG-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.81 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|