About CID 131878530
CID 131878530 (PubChem CID 131878530) has the molecular formula C12H22Br8MgO8P2
and a molecular weight of 1019.78 g/mol.
Molecular Properties
| Compound Name | CID 131878530 |
| PubChem CID | 131878530 |
| Molecular Formula | C12H22Br8MgO8P2 |
| Molecular Weight | 1019.78 g/mol |
| Exact Mass | 1011.41 |
| IUPAC Name | — |
| SMILES | O=P(O)(OCC(Br)CBr)OCC(Br)CBr.O=P(O)(OCC(Br)CBr)OCC(Br)CBr.[Mg] |
| InChI | InChI=1S/2C6H11Br4O4P.Mg/c2*7-1-5(9)3-13-15(11,12)14-4-6(10)2-8;/h2*5-6H,1-4H2,(H,11,12); |
| InChIKey | WWQDKLDPEVUXQV-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1019.78 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 131878530 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 131878530?
The IUPAC name of CID 131878530 (CID 131878530) is not available.
What is the SMILES notation for CID 131878530?
The canonical SMILES for CID 131878530 is O=P(O)(OCC(Br)CBr)OCC(Br)CBr.O=P(O)(OCC(Br)CBr)OCC(Br)CBr.[Mg].
What is the InChIKey of CID 131878530?
The InChIKey is WWQDKLDPEVUXQV-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H11Br4O4P.Mg/c2*7-1-5(9)3-13-15(11,12)14-4-6(10)2-8;/h2*5-6H,1-4H2,(H,11,12);.
What are the key properties of CID 131878530?
CID 131878530 has a molecular weight of 1019.78 g/mol, XLogP of 6.49, 16 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 131878530 is sourced from PubChem (CID 131878530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).