C8H13Br6O3P — CID 54507285
1,2-dibromo-3-[1,2-dibromoethyl(2,3-dibromopropoxy)phosphoryl]oxypropane (PubChem CID 54507285) has the molecular formula C8H13Br6O3P and a molecular weight of 667.59 g/mol. Its IUPAC name is 1,2-dibromo-3-[1,2-dibromoethyl(2,3-dibromopropoxy)phosphoryl]oxypropane.
| Compound Name | 1,2-dibromo-3-[1,2-dibromoethyl(2,3-dibromopropoxy)phosphoryl]oxypropane |
|---|---|
| PubChem CID | 54507285 |
| Molecular Formula | C8H13Br6O3P |
| Molecular Weight | 667.59 g/mol |
| Exact Mass | 661.57 |
| IUPAC Name | 1,2-dibromo-3-[1,2-dibromoethyl(2,3-dibromopropoxy)phosphoryl]oxypropane |
| SMILES | O=P(OCC(Br)CBr)(OCC(Br)CBr)C(Br)CBr |
| InChI | InChI=1S/C8H13Br6O3P/c9-1-6(12)4-16-18(15,8(14)3-11)17-5-7(13)2-10/h6-8H,1-5H2 |
| InChIKey | YGPIZSHTEYKENT-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.59 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|