2,3-dibromopropyl hydrogen sulfate

C3H6Br2O4S — CID 3015809

IUPAC2,3-dibromopropyl hydrogen sulfate
SMILESO=S(=O)(O)OCC(Br)CBr
InChIInChI=1S/C3H6Br2O4S/c4-1-3(5)2-9-10(6,7)8/h3H,1-2H2,(H,6,7,8)
InChIKeyFSRLUIVKALGLMR-UHFFFAOYSA-N
MW297.95 g/mol
LogP0.96
Rot. Bonds4

About 2,3-dibromopropyl hydrogen sulfate

2,3-dibromopropyl hydrogen sulfate (PubChem CID 3015809) has the molecular formula C3H6Br2O4S and a molecular weight of 297.95 g/mol. Its IUPAC name is 2,3-dibromopropyl hydrogen sulfate.

Molecular Properties

Compound Name2,3-dibromopropyl hydrogen sulfate
PubChem CID3015809
Molecular FormulaC3H6Br2O4S
Molecular Weight297.95 g/mol
Exact Mass295.84
IUPAC Name2,3-dibromopropyl hydrogen sulfate
SMILESO=S(=O)(O)OCC(Br)CBr
InChIInChI=1S/C3H6Br2O4S/c4-1-3(5)2-9-10(6,7)8/h3H,1-2H2,(H,6,7,8)
InChIKeyFSRLUIVKALGLMR-UHFFFAOYSA-N
XLogP0.96
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500297.95
LogP ≤ 50.96
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 2,3-dibromopropyl hydrogen sulfate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,3-dibromopropyl hydrogen sulfate?
The IUPAC name of 2,3-dibromopropyl hydrogen sulfate (CID 3015809) is 2,3-dibromopropyl hydrogen sulfate.
What is the SMILES notation for 2,3-dibromopropyl hydrogen sulfate?
The canonical SMILES for 2,3-dibromopropyl hydrogen sulfate is O=S(=O)(O)OCC(Br)CBr.
What is the InChIKey of 2,3-dibromopropyl hydrogen sulfate?
The InChIKey is FSRLUIVKALGLMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6Br2O4S/c4-1-3(5)2-9-10(6,7)8/h3H,1-2H2,(H,6,7,8).
What are the key properties of 2,3-dibromopropyl hydrogen sulfate?
2,3-dibromopropyl hydrogen sulfate has a molecular weight of 297.95 g/mol, XLogP of 0.96, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dibromopropyl hydrogen sulfate is sourced from PubChem (CID 3015809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).