C9H15Br4Cl2O4P — CID 129370864
[(2R,5S)-5,6-dibromo-2,3-dichloro-3-[(2S)-2,3-dibromopropyl]hexyl] dihydrogen phosphate (PubChem CID 129370864) has the molecular formula C9H15Br4Cl2O4P and a molecular weight of 608.71 g/mol. Its IUPAC name is [(2R,5S)-5,6-dibromo-2,3-dichloro-3-[(2S)-2,3-dibromopropyl]hexyl] dihydrogen phosphate.
| Compound Name | [(2R,5S)-5,6-dibromo-2,3-dichloro-3-[(2S)-2,3-dibromopropyl]hexyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 129370864 |
| Molecular Formula | C9H15Br4Cl2O4P |
| Molecular Weight | 608.71 g/mol |
| Exact Mass | 603.68 |
| IUPAC Name | [(2R,5S)-5,6-dibromo-2,3-dichloro-3-[(2S)-2,3-dibromopropyl]hexyl] dihydrogen phosphate |
| SMILES | O=P(O)(O)OC[C@@H](Cl)C(Cl)(C[C@H](Br)CBr)C[C@H](Br)CBr |
| InChI | InChI=1S/C9H15Br4Cl2O4P/c10-3-6(12)1-9(15,2-7(13)4-11)8(14)5-19-20(16,17)18/h6-8H,1-5H2,(H2,16,17,18)/t6-,7-,8+/m0/s1 |
| InChIKey | PEYHCNXARVVQOW-BIIVOSGPSA-N |
| XLogP | 4.78 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.71 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|