C12H22Br4ClO4P — CID 54543567
[1,2-dibromo-9-chloro-4-(2,3-dibromopropyl)nonan-4-yl] dihydrogen phosphate (PubChem CID 54543567) has the molecular formula C12H22Br4ClO4P and a molecular weight of 616.35 g/mol. Its IUPAC name is [1,2-dibromo-9-chloro-4-(2,3-dibromopropyl)nonan-4-yl] dihydrogen phosphate.
| Compound Name | [1,2-dibromo-9-chloro-4-(2,3-dibromopropyl)nonan-4-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 54543567 |
| Molecular Formula | C12H22Br4ClO4P |
| Molecular Weight | 616.35 g/mol |
| Exact Mass | 611.77 |
| IUPAC Name | [1,2-dibromo-9-chloro-4-(2,3-dibromopropyl)nonan-4-yl] dihydrogen phosphate |
| SMILES | O=P(O)(O)OC(CCCCCCl)(CC(Br)CBr)CC(Br)CBr |
| InChI | InChI=1S/C12H22Br4ClO4P/c13-8-10(15)6-12(7-11(16)9-14,21-22(18,19)20)4-2-1-3-5-17/h10-11H,1-9H2,(H2,18,19,20) |
| InChIKey | ZEYTWHDJBRTGJA-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.35 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|