C7H15Br2O5P — CID 88747046
[1-bromo-2-(bromomethyl)-5-hydroxyhexan-2-yl] dihydrogen phosphate (PubChem CID 88747046) has the molecular formula C7H15Br2O5P and a molecular weight of 369.97 g/mol. Its IUPAC name is [1-bromo-2-(bromomethyl)-5-hydroxyhexan-2-yl] dihydrogen phosphate.
| Compound Name | [1-bromo-2-(bromomethyl)-5-hydroxyhexan-2-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 88747046 |
| Molecular Formula | C7H15Br2O5P |
| Molecular Weight | 369.97 g/mol |
| Exact Mass | 367.90 |
| IUPAC Name | [1-bromo-2-(bromomethyl)-5-hydroxyhexan-2-yl] dihydrogen phosphate |
| SMILES | CC(O)CCC(CBr)(CBr)OP(=O)(O)O |
| InChI | InChI=1S/C7H15Br2O5P/c1-6(10)2-3-7(4-8,5-9)14-15(11,12)13/h6,10H,2-5H2,1H3,(H2,11,12,13) |
| InChIKey | WBTSMTOREOHGDF-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.97 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|