C11H18Br3Cl4O4P — CID 19888764
[5,6,8-tribromo-1,2-dichloro-4-(2,3-dichloropropyl)octan-4-yl] dihydrogen phosphate (PubChem CID 19888764) has the molecular formula C11H18Br3Cl4O4P and a molecular weight of 626.76 g/mol. Its IUPAC name is [5,6,8-tribromo-1,2-dichloro-4-(2,3-dichloropropyl)octan-4-yl] dihydrogen phosphate.
| Compound Name | [5,6,8-tribromo-1,2-dichloro-4-(2,3-dichloropropyl)octan-4-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 19888764 |
| Molecular Formula | C11H18Br3Cl4O4P |
| Molecular Weight | 626.76 g/mol |
| Exact Mass | 621.72 |
| IUPAC Name | [5,6,8-tribromo-1,2-dichloro-4-(2,3-dichloropropyl)octan-4-yl] dihydrogen phosphate |
| SMILES | O=P(O)(O)OC(CC(Cl)CCl)(CC(Cl)CCl)C(Br)C(Br)CCBr |
| InChI | InChI=1S/C11H18Br3Cl4O4P/c12-2-1-9(13)10(14)11(3-7(17)5-15,4-8(18)6-16)22-23(19,20)21/h7-10H,1-6H2,(H2,19,20,21) |
| InChIKey | UCNDIWRMYNGFPJ-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.76 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|