C11H18Br4Cl3O4P — CID 88828759
[5,6-dibromo-1-chloro-2,3-bis(chloromethyl)-3-(2,3-dibromopropyl)hexan-2-yl] dihydrogen phosphate (PubChem CID 88828759) has the molecular formula C11H18Br4Cl3O4P and a molecular weight of 671.21 g/mol. Its IUPAC name is [5,6-dibromo-1-chloro-2,3-bis(chloromethyl)-3-(2,3-dibromopropyl)hexan-2-yl] dihydrogen phosphate.
| Compound Name | [5,6-dibromo-1-chloro-2,3-bis(chloromethyl)-3-(2,3-dibromopropyl)hexan-2-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 88828759 |
| Molecular Formula | C11H18Br4Cl3O4P |
| Molecular Weight | 671.21 g/mol |
| Exact Mass | 665.67 |
| IUPAC Name | [5,6-dibromo-1-chloro-2,3-bis(chloromethyl)-3-(2,3-dibromopropyl)hexan-2-yl] dihydrogen phosphate |
| SMILES | O=P(O)(O)OC(CCl)(CCl)C(CCl)(CC(Br)CBr)CC(Br)CBr |
| InChI | InChI=1S/C11H18Br4Cl3O4P/c12-3-8(14)1-10(5-16,2-9(15)4-13)11(6-17,7-18)22-23(19,20)21/h8-9H,1-7H2,(H2,19,20,21) |
| InChIKey | OXABSFKXHBICGW-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.21 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|